C28H24Cl3N5OS — CID 135663716
2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663716) has the molecular formula C28H24Cl3N5OS and a molecular weight of 584.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663716 |
| Molecular Formula | C28H24Cl3N5OS |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(Cl)c(Cl)c2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C28H24Cl3N5OS/c1-15-8-11-23(16(2)12-15)33-26(37)24-17(3)32-27-34-28(38-14-19-6-4-5-7-20(19)29)35-36(27)25(24)18-9-10-21(30)22(31)13-18/h4-13,25H,14H2,1-3H3,(H,33,37)(H,32,34,35) |
| InChIKey | QWNDPJFKJSOXEL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |