C28H25ClFN5OS — CID 135663370
2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663370) has the molecular formula C28H25ClFN5OS and a molecular weight of 534.06 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663370 |
| Molecular Formula | C28H25ClFN5OS |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-7-(4-fluorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(F)cc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C28H25ClFN5OS/c1-16-8-13-23(17(2)14-16)32-26(36)24-18(3)31-27-33-28(37-15-20-6-4-5-7-22(20)29)34-35(27)25(24)19-9-11-21(30)12-10-19/h4-14,25H,15H2,1-3H3,(H,32,36)(H,31,33,34) |
| InChIKey | DYNUPCLDMFSDFM-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |