C26H23BrClN5O2S — CID 135663774
7-(5-bromofuran-2-yl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663774) has the molecular formula C26H23BrClN5O2S and a molecular weight of 584.93 g/mol. Its IUPAC name is 7-(5-bromofuran-2-yl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(5-bromofuran-2-yl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663774 |
| Molecular Formula | C26H23BrClN5O2S |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 7-(5-bromofuran-2-yl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(Br)o2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C26H23BrClN5O2S/c1-14-8-9-19(15(2)12-14)30-24(34)22-16(3)29-25-31-26(36-13-17-6-4-5-7-18(17)28)32-33(25)23(22)20-10-11-21(27)35-20/h4-12,23H,13H2,1-3H3,(H,30,34)(H,29,31,32) |
| InChIKey | DHWSIJPIDZWRON-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |