C31H33N5O2S — CID 135793809
2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-(3-propoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793809) has the molecular formula C31H33N5O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-(3-propoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-(3-propoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793809 |
| Molecular Formula | C31H33N5O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,4-dimethylphenyl)-5-methyl-7-(3-propoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCOc1cccc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3nc(SCc4ccccc4)nn32)c1 |
| InChI | InChI=1S/C31H33N5O2S/c1-5-16-38-25-13-9-12-24(18-25)28-27(29(37)33-26-15-14-20(2)17-21(26)3)22(4)32-30-34-31(35-36(28)30)39-19-23-10-7-6-8-11-23/h6-15,17-18,28H,5,16,19H2,1-4H3,(H,33,37)(H,32,34,35) |
| InChIKey | JOKIZLVNLVJOTK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |