C21H18ClN5O4S — CID 135664742
1-[2-[(2-chlorophenyl)methylsulfanyl]-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135664742) has the molecular formula C21H18ClN5O4S and a molecular weight of 471.93 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135664742 |
| Molecular Formula | C21H18ClN5O4S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18ClN5O4S/c1-11-18(12(2)28)19(13-7-8-17(29)16(9-13)27(30)31)26-20(23-11)24-21(25-26)32-10-14-5-3-4-6-15(14)22/h3-9,19,29H,10H2,1-2H3,(H,23,24,25) |
| InChIKey | GRWZQIIKQLTWGP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|