C32H33Cl2N5O3S — CID 135661916
7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(3-methylphenyl)-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135661916) has the molecular formula C32H33Cl2N5O3S and a molecular weight of 638.62 g/mol. Its IUPAC name is 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(3-methylphenyl)-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(3-methylphenyl)-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135661916 |
| Molecular Formula | C32H33Cl2N5O3S |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]-5-methyl-N-(3-methylphenyl)-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCc3c(Cl)cccc3Cl)c(OCC)c1)C(C(=O)Nc1cccc(C)c1)=C(C)N2 |
| InChI | InChI=1S/C32H33Cl2N5O3S/c1-5-15-43-32-37-31-35-20(4)28(30(40)36-22-10-7-9-19(3)16-22)29(39(31)38-32)21-13-14-26(27(17-21)41-6-2)42-18-23-24(33)11-8-12-25(23)34/h7-14,16-17,29H,5-6,15,18H2,1-4H3,(H,36,40)(H,35,37,38) |
| InChIKey | IDZMGFQRFXSZHH-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |