C25H26Cl2N4O3S — CID 135806712
1-[7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (PubChem CID 135806712) has the molecular formula C25H26Cl2N4O3S and a molecular weight of 533.48 g/mol. Its IUPAC name is 1-[7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone.
| Compound Name | 1-[7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
|---|---|
| PubChem CID | 135806712 |
| Molecular Formula | C25H26Cl2N4O3S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 1-[7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCc3c(Cl)cccc3Cl)c(OC)c1)C(C(C)=O)=C(C)N2 |
| InChI | InChI=1S/C25H26Cl2N4O3S/c1-5-11-35-25-29-24-28-14(2)22(15(3)32)23(31(24)30-25)16-9-10-20(21(12-16)33-4)34-13-17-18(26)7-6-8-19(17)27/h6-10,12,23H,5,11,13H2,1-4H3,(H,28,29,30) |
| InChIKey | WELFHRZRMUXRIQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |