C19H25N5O4 — CID 136842912
pentyl (7S)-7-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136842912) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is pentyl (7S)-7-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | pentyl (7S)-7-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136842912 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | pentyl (7S)-7-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCOC(=O)C1=C(C)Nc2nnnn2[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H25N5O4/c1-5-6-7-10-28-18(25)16-12(2)20-19-21-22-23-24(19)17(16)13-8-9-14(26-3)15(11-13)27-4/h8-9,11,17H,5-7,10H2,1-4H3,(H,20,21,23)/t17-/m0/s1 |
| InChIKey | CSBVBIPIIAITGX-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|