C17H20ClN5O2 — CID 135573115
pentyl 7-(3-chlorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135573115) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is pentyl 7-(3-chlorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | pentyl 7-(3-chlorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135573115 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | pentyl 7-(3-chlorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCOC(=O)C1=C(C)Nc2nnnn2C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-3-4-5-9-25-16(24)14-11(2)19-17-20-21-22-23(17)15(14)12-7-6-8-13(18)10-12/h6-8,10,15H,3-5,9H2,1-2H3,(H,19,20,22) |
| InChIKey | XYAAEVHHPDKNFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|