C20H25ClFN5O2 — CID 136719855
octyl (7S)-7-(2-chloro-6-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136719855) has the molecular formula C20H25ClFN5O2 and a molecular weight of 421.90 g/mol. Its IUPAC name is octyl (7S)-7-(2-chloro-6-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | octyl (7S)-7-(2-chloro-6-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136719855 |
| Molecular Formula | C20H25ClFN5O2 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | octyl (7S)-7-(2-chloro-6-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)Nc2nnnn2[C@@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H25ClFN5O2/c1-3-4-5-6-7-8-12-29-19(28)16-13(2)23-20-24-25-26-27(20)18(16)17-14(21)10-9-11-15(17)22/h9-11,18H,3-8,12H2,1-2H3,(H,23,24,26)/t18-/m0/s1 |
| InChIKey | VKOYFPOUMOSNIK-SFHVURJKSA-N |
| XLogP | 4.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|