C19H24FN5O2 — CID 135572491
heptyl 7-(2-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135572491) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is heptyl 7-(2-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | heptyl 7-(2-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135572491 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | heptyl 7-(2-fluorophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2nnnn2C1c1ccccc1F |
| InChI | InChI=1S/C19H24FN5O2/c1-3-4-5-6-9-12-27-18(26)16-13(2)21-19-22-23-24-25(19)17(16)14-10-7-8-11-15(14)20/h7-8,10-11,17H,3-6,9,12H2,1-2H3,(H,21,22,24) |
| InChIKey | SUQVJXTXKBMANL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|