C18H21N5O4 — CID 135633104
4-(5-methyl-6-pentoxycarbonyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)benzoic acid (PubChem CID 135633104) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-(5-methyl-6-pentoxycarbonyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)benzoic acid.
| Compound Name | 4-(5-methyl-6-pentoxycarbonyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)benzoic acid |
|---|---|
| PubChem CID | 135633104 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-(5-methyl-6-pentoxycarbonyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-7-yl)benzoic acid |
| SMILES | CCCCCOC(=O)C1=C(C)Nc2nnnn2C1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-3-4-5-10-27-17(26)14-11(2)19-18-20-21-22-23(18)15(14)12-6-8-13(9-7-12)16(24)25/h6-9,15H,3-5,10H2,1-2H3,(H,24,25)(H,19,20,22) |
| InChIKey | VPBQVKMFWFZBLQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|