C23H22N4O5 — CID 982826
[(2S)-oxolan-2-yl]methyl (4S)-2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 982826) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl (4S)-2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl (4S)-2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 982826 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl (4S)-2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CC1=C(C(=O)OC[C@@H]2CCCO2)[C@H](c2ccccc2[N+](=O)[O-])n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C23H22N4O5/c1-14-20(22(28)32-13-15-7-6-12-31-15)21(16-8-2-4-10-18(16)27(29)30)26-19-11-5-3-9-17(19)25-23(26)24-14/h2-5,8-11,15,21H,6-7,12-13H2,1H3,(H,24,25)/t15-,21-/m0/s1 |
| InChIKey | VEGCMRRTCKDGEJ-BTYIYWSLSA-N |
| XLogP | 3.96 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|