C21H17ClN4O4 — CID 17228278
prop-2-enyl 4-(2-chloro-5-nitrophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 17228278) has the molecular formula C21H17ClN4O4 and a molecular weight of 424.84 g/mol. Its IUPAC name is prop-2-enyl 4-(2-chloro-5-nitrophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | prop-2-enyl 4-(2-chloro-5-nitrophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 17228278 |
| Molecular Formula | C21H17ClN4O4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | prop-2-enyl 4-(2-chloro-5-nitrophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc3ccccc3n2C1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H17ClN4O4/c1-3-10-30-20(27)18-12(2)23-21-24-16-6-4-5-7-17(16)25(21)19(18)14-11-13(26(28)29)8-9-15(14)22/h3-9,11,19H,1,10H2,2H3,(H,23,24) |
| InChIKey | HNNRVYFPQSNTAR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|