C20H19N3O2S — CID 17198014
prop-2-enyl 2-methyl-4-(3-methylthiophen-2-yl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 17198014) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is prop-2-enyl 2-methyl-4-(3-methylthiophen-2-yl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | prop-2-enyl 2-methyl-4-(3-methylthiophen-2-yl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 17198014 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | prop-2-enyl 2-methyl-4-(3-methylthiophen-2-yl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc3ccccc3n2C1c1sccc1C |
| InChI | InChI=1S/C20H19N3O2S/c1-4-10-25-19(24)16-13(3)21-20-22-14-7-5-6-8-15(14)23(20)17(16)18-12(2)9-11-26-18/h4-9,11,17H,1,10H2,2-3H3,(H,21,22) |
| InChIKey | VXYFMNKBTFSIIY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|