C25H21N3O2 — CID 29101122
prop-2-enyl (4R)-2-methyl-4-naphthalen-1-yl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29101122) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is prop-2-enyl (4R)-2-methyl-4-naphthalen-1-yl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | prop-2-enyl (4R)-2-methyl-4-naphthalen-1-yl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29101122 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | prop-2-enyl (4R)-2-methyl-4-naphthalen-1-yl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc3ccccc3n2[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H21N3O2/c1-3-15-30-24(29)22-16(2)26-25-27-20-13-6-7-14-21(20)28(25)23(22)19-12-8-10-17-9-4-5-11-18(17)19/h3-14,23H,1,15H2,2H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | UJHIMNZDCFYXHP-HSZRJFAPSA-N |
| XLogP | 5.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|