C24H17ClFN5O3 — CID 92707173
(4R)-4-(2-chloro-5-nitrophenyl)-N-(4-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide (PubChem CID 92707173) has the molecular formula C24H17ClFN5O3 and a molecular weight of 477.88 g/mol. Its IUPAC name is (4R)-4-(2-chloro-5-nitrophenyl)-N-(4-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | (4R)-4-(2-chloro-5-nitrophenyl)-N-(4-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 92707173 |
| Molecular Formula | C24H17ClFN5O3 |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (4R)-4-(2-chloro-5-nitrophenyl)-N-(4-fluorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(F)cc2)[C@H](c2cc([N+](=O)[O-])ccc2Cl)n2c(nc3ccccc32)N1 |
| InChI | InChI=1S/C24H17ClFN5O3/c1-13-21(23(32)28-15-8-6-14(26)7-9-15)22(17-12-16(31(33)34)10-11-18(17)25)30-20-5-3-2-4-19(20)29-24(30)27-13/h2-12,22H,1H3,(H,27,29)(H,28,32)/t22-/m0/s1 |
| InChIKey | AGSDRFYPEDUQOA-QFIPXVFZSA-N |
| XLogP | 5.66 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|