C25H31N3O5 — CID 154479248
heptyl 1-carbamoyl-2,6-dimethyl-4-(2-nitrophenyl)-5-prop-2-ynyl-4H-pyridine-3-carboxylate (PubChem CID 154479248) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is heptyl 1-carbamoyl-2,6-dimethyl-4-(2-nitrophenyl)-5-prop-2-ynyl-4H-pyridine-3-carboxylate.
| Compound Name | heptyl 1-carbamoyl-2,6-dimethyl-4-(2-nitrophenyl)-5-prop-2-ynyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 154479248 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | heptyl 1-carbamoyl-2,6-dimethyl-4-(2-nitrophenyl)-5-prop-2-ynyl-4H-pyridine-3-carboxylate |
| SMILES | C#CCC1=C(C)N(C(N)=O)C(C)=C(C(=O)OCCCCCCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H31N3O5/c1-5-7-8-9-12-16-33-24(29)22-18(4)27(25(26)30)17(3)19(13-6-2)23(22)20-14-10-11-15-21(20)28(31)32/h2,10-11,14-15,23H,5,7-9,12-13,16H2,1,3-4H3,(H2,26,30) |
| InChIKey | LGJXUWLYVQEHIA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|