C34H45NO6 — CID 158199141
dioctyl benzene-1,2-dicarboxylate;1-nitronaphthalene (PubChem CID 158199141) has the molecular formula C34H45NO6 and a molecular weight of 563.74 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;1-nitronaphthalene.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;1-nitronaphthalene |
|---|---|
| PubChem CID | 158199141 |
| Molecular Formula | C34H45NO6 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;1-nitronaphthalene |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=[N+]([O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C24H38O4.C10H7NO2/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-7H |
| InChIKey | GASHFZWRYQMMMU-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|