C26H35N3O5 — CID 154479253
octyl 1-carbamoyl-5-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3-carboxylate (PubChem CID 154479253) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is octyl 1-carbamoyl-5-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3-carboxylate.
| Compound Name | octyl 1-carbamoyl-5-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 154479253 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | octyl 1-carbamoyl-5-cyclopropyl-2,6-dimethyl-4-(2-nitrophenyl)-4H-pyridine-3-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)N(C(N)=O)C(C)=C(C2CC2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H35N3O5/c1-4-5-6-7-8-11-16-34-25(30)23-18(3)28(26(27)31)17(2)22(19-14-15-19)24(23)20-12-9-10-13-21(20)29(32)33/h9-10,12-13,19,24H,4-8,11,14-16H2,1-3H3,(H2,27,31) |
| InChIKey | GKGQYOOEFHTOHQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|