C20H24IN2O6- — CID 160581943
butyliodanuidyl 2,5,6-trimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;carbon dioxide (PubChem CID 160581943) has the molecular formula C20H24IN2O6- and a molecular weight of 515.32 g/mol. Its IUPAC name is butyliodanuidyl 2,5,6-trimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;carbon dioxide.
| Compound Name | butyliodanuidyl 2,5,6-trimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;carbon dioxide |
|---|---|
| PubChem CID | 160581943 |
| Molecular Formula | C20H24IN2O6- |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | butyliodanuidyl 2,5,6-trimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;carbon dioxide |
| SMILES | CCCC[I-]OC(=O)C1=C(C)NC(C)=C(C)C1c1ccccc1[N+](=O)[O-].O=C=O |
| InChI | InChI=1S/C19H24IN2O4.CO2/c1-5-6-11-20-26-19(23)18-14(4)21-13(3)12(2)17(18)15-9-7-8-10-16(15)22(24)25;2-1-3/h7-10,17,21H,5-6,11H2,1-4H3;/q-1; |
| InChIKey | DXIXDPUMYSNJKW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|