C32H39N5O9 — CID 10100629
3-O-(1-benzylpiperidin-4-yl) 5-O-(6-nitrooxyhexyl) 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10100629) has the molecular formula C32H39N5O9 and a molecular weight of 637.69 g/mol. Its IUPAC name is 3-O-(1-benzylpiperidin-4-yl) 5-O-(6-nitrooxyhexyl) 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(1-benzylpiperidin-4-yl) 5-O-(6-nitrooxyhexyl) 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10100629 |
| Molecular Formula | C32H39N5O9 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 3-O-(1-benzylpiperidin-4-yl) 5-O-(6-nitrooxyhexyl) 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCCCCO[N+](=O)[O-])C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC2CCN(Cc3ccccc3)CC2)=C(N)N1 |
| InChI | InChI=1S/C32H39N5O9/c1-22-27(31(38)44-18-7-2-3-8-19-45-37(42)43)28(24-12-9-13-25(20-24)36(40)41)29(30(33)34-22)32(39)46-26-14-16-35(17-15-26)21-23-10-5-4-6-11-23/h4-6,9-13,20,26,28,34H,2-3,7-8,14-19,21,33H2,1H3 |
| InChIKey | OINCPSPOXIOSHO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 189.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|