C27H29N3O6 — CID 123133889
5-[(3S)-1-benzylpiperidin-3-yl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 123133889) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 5-[(3S)-1-benzylpiperidin-3-yl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[(3S)-1-benzylpiperidin-3-yl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123133889 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 5-[(3S)-1-benzylpiperidin-3-yl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O[C@H]2CCCN(Cc3ccccc3)C2)=C(C)N1 |
| InChI | InChI=1S/C27H29N3O6/c1-17-23(26(31)32)25(20-10-6-11-21(14-20)30(34)35)24(18(2)28-17)27(33)36-22-12-7-13-29(16-22)15-19-8-4-3-5-9-19/h3-6,8-11,14,22,25,28H,7,12-13,15-16H2,1-2H3,(H,31,32)/t22-,25?/m0/s1 |
| InChIKey | OANDGDOGRDMPDM-XADRRFQNSA-N |
| XLogP | 4.12 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|