C49H60N4O8 — CID 70425260
bis[4-(1-benzylpiperidin-4-yl)-5-methyloxolan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70425260) has the molecular formula C49H60N4O8 and a molecular weight of 833.04 g/mol. Its IUPAC name is bis[4-(1-benzylpiperidin-4-yl)-5-methyloxolan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[4-(1-benzylpiperidin-4-yl)-5-methyloxolan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70425260 |
| Molecular Formula | C49H60N4O8 |
| Molecular Weight | 833.04 g/mol |
| Exact Mass | 832.44 |
| IUPAC Name | bis[4-(1-benzylpiperidin-4-yl)-5-methyloxolan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC2CC(C3CCN(Cc4ccccc4)CC3)C(C)O2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC2CC(C3CCN(Cc4ccccc4)CC3)C(C)O2)=C(C)N1 |
| InChI | InChI=1S/C49H60N4O8/c1-31-45(48(54)60-43-27-41(33(3)58-43)37-18-22-51(23-19-37)29-35-12-7-5-8-13-35)47(39-16-11-17-40(26-39)53(56)57)46(32(2)50-31)49(55)61-44-28-42(34(4)59-44)38-20-24-52(25-21-38)30-36-14-9-6-10-15-36/h5-17,26,33-34,37-38,41-44,47,50H,18-25,27-30H2,1-4H3 |
| InChIKey | ZZFPTPOHJAJEHB-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.04 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|