C28H32ClN3O6 — CID 45357925
5-O-(1-benzylpiperidin-2-yl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 45357925) has the molecular formula C28H32ClN3O6 and a molecular weight of 542.03 g/mol. Its IUPAC name is 5-O-(1-benzylpiperidin-2-yl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | 5-O-(1-benzylpiperidin-2-yl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 45357925 |
| Molecular Formula | C28H32ClN3O6 |
| Molecular Weight | 542.03 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 5-O-(1-benzylpiperidin-2-yl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2CCCCN2Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C28H31N3O6.ClH/c1-18-24(27(32)36-3)26(21-12-9-13-22(16-21)31(34)35)25(19(2)29-18)28(33)37-23-14-7-8-15-30(23)17-20-10-5-4-6-11-20;/h4-6,9-13,16,23,26,29H,7-8,14-15,17H2,1-3H3;1H |
| InChIKey | YFNLBEYTBVYJAU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.03 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|