C29H33N3O6 — CID 77146912
3-O-methyl 5-O-[3-methyl-1-(2-phenylethyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 77146912) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3-O-methyl 5-O-[3-methyl-1-(2-phenylethyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[3-methyl-1-(2-phenylethyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 77146912 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 3-O-methyl 5-O-[3-methyl-1-(2-phenylethyl)pyrrolidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2(C)CCN(CCc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H33N3O6/c1-19-24(27(33)37-4)26(22-11-8-12-23(17-22)32(35)36)25(20(2)30-19)28(34)38-29(3)14-16-31(18-29)15-13-21-9-6-5-7-10-21/h5-12,17,26,30H,13-16,18H2,1-4H3 |
| InChIKey | NXVGGQRODJPTTQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|