C37H41N3O6 — CID 66576446
5-O-[(3S)-1-(3,3-diphenylpropyl)-3-methylpyrrolidin-3-yl] 3-O-ethyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 66576446) has the molecular formula C37H41N3O6 and a molecular weight of 623.75 g/mol. Its IUPAC name is 5-O-[(3S)-1-(3,3-diphenylpropyl)-3-methylpyrrolidin-3-yl] 3-O-ethyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[(3S)-1-(3,3-diphenylpropyl)-3-methylpyrrolidin-3-yl] 3-O-ethyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 66576446 |
| Molecular Formula | C37H41N3O6 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 5-O-[(3S)-1-(3,3-diphenylpropyl)-3-methylpyrrolidin-3-yl] 3-O-ethyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)O[C@@]2(C)CCN(CCC(c3ccccc3)c3ccccc3)C2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H41N3O6/c1-5-45-35(41)32-25(2)38-26(3)33(34(32)29-17-12-18-30(23-29)40(43)44)36(42)46-37(4)20-22-39(24-37)21-19-31(27-13-8-6-9-14-27)28-15-10-7-11-16-28/h6-18,23,31,34,38H,5,19-22,24H2,1-4H3/t34-,37-/m0/s1 |
| InChIKey | OEKTXYNZSNUVEG-UNVMMQEESA-N |
| XLogP | 6.62 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|