C38H43N5O9 — CID 10078532
3-O-[3-(4-benzhydrylpiperazin-1-yl)propyl] 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10078532) has the molecular formula C38H43N5O9 and a molecular weight of 713.79 g/mol. Its IUPAC name is 3-O-[3-(4-benzhydrylpiperazin-1-yl)propyl] 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[3-(4-benzhydrylpiperazin-1-yl)propyl] 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10078532 |
| Molecular Formula | C38H43N5O9 |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 3-O-[3-(4-benzhydrylpiperazin-1-yl)propyl] 5-O-(3-nitrooxypropyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCO[N+](=O)[O-])C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)=C(C)N1 |
| InChI | InChI=1S/C38H43N5O9/c1-27-33(35(31-16-9-17-32(26-31)42(46)47)34(28(2)39-27)38(45)51-24-11-25-52-43(48)49)37(44)50-23-10-18-40-19-21-41(22-20-40)36(29-12-5-3-6-13-29)30-14-7-4-8-15-30/h3-9,12-17,26,35-36,39H,10-11,18-25H2,1-2H3 |
| InChIKey | HXOGOBPENOSEJY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|