C39H47N4O7P — CID 10259267
3-(4-benzhydrylpiperazin-1-yl)propyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 10259267) has the molecular formula C39H47N4O7P and a molecular weight of 714.80 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)propyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)propyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10259267 |
| Molecular Formula | C39H47N4O7P |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)propyl 5-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)C(c2cccc([N+](=O)[O-])c2)C(P2(=O)OCC(C)(C)CO2)=C(C)N1 |
| InChI | InChI=1S/C39H47N4O7P/c1-28-34(35(32-17-11-18-33(25-32)43(45)46)37(29(2)40-28)51(47)49-26-39(3,4)27-50-51)38(44)48-24-12-19-41-20-22-42(23-21-41)36(30-13-7-5-8-14-30)31-15-9-6-10-16-31/h5-11,13-18,25,35-36,40H,12,19-24,26-27H2,1-4H3 |
| InChIKey | HQGONOSZYNVJBW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|