C34H37N5O6 — CID 59993586
3-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 5-O-methyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 59993586) has the molecular formula C34H37N5O6 and a molecular weight of 611.70 g/mol. Its IUPAC name is 3-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 5-O-methyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 5-O-methyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 59993586 |
| Molecular Formula | C34H37N5O6 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 3-O-[2-(4-benzhydrylpiperazin-1-yl)ethyl] 5-O-methyl 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(N)=C(C(=O)OCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H37N5O6/c1-23-28(33(40)44-2)29(26-14-9-15-27(22-26)39(42)43)30(32(35)36-23)34(41)45-21-20-37-16-18-38(19-17-37)31(24-10-5-3-6-11-24)25-12-7-4-8-13-25/h3-15,22,29,31,36H,16-21,35H2,1-2H3 |
| InChIKey | IRABZLCXWNSUSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|