C34H44N4O8 — CID 25053867
5-O-[4-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 25053867) has the molecular formula C34H44N4O8 and a molecular weight of 636.75 g/mol. Its IUPAC name is 5-O-[4-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[4-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25053867 |
| Molecular Formula | C34H44N4O8 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 5-O-[4-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCN2CCN(CCCOc3ccccc3OC)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H44N4O8/c1-24-30(33(39)44-4)32(26-11-9-12-27(23-26)38(41)42)31(25(2)35-24)34(40)46-21-8-7-15-36-17-19-37(20-18-36)16-10-22-45-29-14-6-5-13-28(29)43-3/h5-6,9,11-14,23,32,35H,7-8,10,15-22H2,1-4H3 |
| InChIKey | NAJYFPOQCAVODU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|