C41H49N3O7 — CID 70432652
5-O-(2-butoxyethyl) 3-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70432652) has the molecular formula C41H49N3O7 and a molecular weight of 695.86 g/mol. Its IUPAC name is 5-O-(2-butoxyethyl) 3-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-butoxyethyl) 3-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70432652 |
| Molecular Formula | C41H49N3O7 |
| Molecular Weight | 695.86 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | 5-O-(2-butoxyethyl) 3-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCOCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C41H49N3O7/c1-4-5-25-49-27-28-51-40(46)37-31(3)42-30(2)36(38(37)32-14-12-19-35(29-32)44(47)48)39(45)50-26-13-22-43-23-20-41(21-24-43,33-15-8-6-9-16-33)34-17-10-7-11-18-34/h6-12,14-19,29,38,42H,4-5,13,20-28H2,1-3H3 |
| InChIKey | VBARPNIKWGEGPF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.86 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|