C39H45N3O4 — CID 18962948
1-[5-acetyl-6-[6-(4,4-diphenylpiperidin-1-yl)hexyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]ethanone (PubChem CID 18962948) has the molecular formula C39H45N3O4 and a molecular weight of 619.81 g/mol. Its IUPAC name is 1-[5-acetyl-6-[6-(4,4-diphenylpiperidin-1-yl)hexyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]ethanone.
| Compound Name | 1-[5-acetyl-6-[6-(4,4-diphenylpiperidin-1-yl)hexyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 18962948 |
| Molecular Formula | C39H45N3O4 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | 1-[5-acetyl-6-[6-(4,4-diphenylpiperidin-1-yl)hexyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3-yl]ethanone |
| SMILES | CC(=O)C1=C(C)NC(CCCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)=C(C(C)=O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C39H45N3O4/c1-28-36(29(2)43)38(31-15-14-20-34(27-31)42(45)46)37(30(3)44)35(40-28)21-12-4-5-13-24-41-25-22-39(23-26-41,32-16-8-6-9-17-32)33-18-10-7-11-19-33/h6-11,14-20,27,38,40H,4-5,12-13,21-26H2,1-3H3 |
| InChIKey | ILFVJEAZNMRUAU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|