C40H46ClN3O4 — CID 10484575
1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-8-(4,4-diphenylpiperidin-1-yl)octan-1-one;hydrochloride (PubChem CID 10484575) has the molecular formula C40H46ClN3O4 and a molecular weight of 668.28 g/mol. Its IUPAC name is 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-8-(4,4-diphenylpiperidin-1-yl)octan-1-one;hydrochloride.
| Compound Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-8-(4,4-diphenylpiperidin-1-yl)octan-1-one;hydrochloride |
|---|---|
| PubChem CID | 10484575 |
| Molecular Formula | C40H46ClN3O4 |
| Molecular Weight | 668.28 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | 1-[5-acetyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-8-(4,4-diphenylpiperidin-1-yl)octan-1-one;hydrochloride |
| SMILES | CC(=O)c1c(C)nc(C)c(C(=O)CCCCCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)c1-c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C40H45N3O4.ClH/c1-29-37(31(3)44)39(32-16-15-21-35(28-32)43(46)47)38(30(2)41-29)36(45)22-13-5-4-6-14-25-42-26-23-40(24-27-42,33-17-9-7-10-18-33)34-19-11-8-12-20-34;/h7-12,15-21,28H,4-6,13-14,22-27H2,1-3H3;1H |
| InChIKey | RWHOMQYLQFGTKE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.28 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|