C39H46ClN3O6 — CID 67820118
tert-butyl 5-acetyl-6-[2-(4,4-diphenylpiperidin-1-yl)ethoxymethyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;hydrochloride (PubChem CID 67820118) has the molecular formula C39H46ClN3O6 and a molecular weight of 688.26 g/mol. Its IUPAC name is tert-butyl 5-acetyl-6-[2-(4,4-diphenylpiperidin-1-yl)ethoxymethyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;hydrochloride.
| Compound Name | tert-butyl 5-acetyl-6-[2-(4,4-diphenylpiperidin-1-yl)ethoxymethyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67820118 |
| Molecular Formula | C39H46ClN3O6 |
| Molecular Weight | 688.26 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | tert-butyl 5-acetyl-6-[2-(4,4-diphenylpiperidin-1-yl)ethoxymethyl]-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;hydrochloride |
| SMILES | CC(=O)C1=C(COCCN2CCC(c3ccccc3)(c3ccccc3)CC2)NC(C)=C(C(=O)OC(C)(C)C)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C39H45N3O6.ClH/c1-27-34(37(44)48-38(3,4)5)36(29-13-12-18-32(25-29)42(45)46)35(28(2)43)33(40-27)26-47-24-23-41-21-19-39(20-22-41,30-14-8-6-9-15-30)31-16-10-7-11-17-31;/h6-18,25,36,40H,19-24,26H2,1-5H3;1H |
| InChIKey | OVLLOVCYMKLRAV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.26 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|