C23H29ClN2O5 — CID 18962971
tert-butyl 5-acetyl-6-(4-chlorobutyl)-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 18962971) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is tert-butyl 5-acetyl-6-(4-chlorobutyl)-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | tert-butyl 5-acetyl-6-(4-chlorobutyl)-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 18962971 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | tert-butyl 5-acetyl-6-(4-chlorobutyl)-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC(=O)C1=C(CCCCCl)NC(C)=C(C(=O)OC(C)(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29ClN2O5/c1-14-19(22(28)31-23(3,4)5)21(16-9-8-10-17(13-16)26(29)30)20(15(2)27)18(25-14)11-6-7-12-24/h8-10,13,21,25H,6-7,11-12H2,1-5H3 |
| InChIKey | PJVOTHZYLCWZNE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|