C18H18BrClN2O6 — CID 95242579
3-O-(2-chloroethyl) 5-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 95242579) has the molecular formula C18H18BrClN2O6 and a molecular weight of 473.71 g/mol. Its IUPAC name is 3-O-(2-chloroethyl) 5-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(2-chloroethyl) 5-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 95242579 |
| Molecular Formula | C18H18BrClN2O6 |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 3-O-(2-chloroethyl) 5-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(CBr)=C(C(=O)OCCCl)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18BrClN2O6/c1-10-14(17(23)27-2)15(11-4-3-5-12(8-11)22(25)26)16(13(9-19)21-10)18(24)28-7-6-20/h3-5,8,15,21H,6-7,9H2,1-2H3/t15-/m1/s1 |
| InChIKey | NJQFKBFAFPOGAP-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|