C22H25BrN2O8 — CID 10896675
5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10896675) has the molecular formula C22H25BrN2O8 and a molecular weight of 525.35 g/mol. Its IUPAC name is 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10896675 |
| Molecular Formula | C22H25BrN2O8 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4R)-2-(bromomethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(CBr)NC(C)=C(C(=O)OCOC(=O)C(C)(C)C)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25BrN2O8/c1-12-16(20(27)32-11-33-21(28)22(2,3)4)17(13-7-6-8-14(9-13)25(29)30)18(19(26)31-5)15(10-23)24-12/h6-9,17,24H,10-11H2,1-5H3/t17-/m1/s1 |
| InChIKey | TWHBQGFIIJHTBS-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|