C29H38N2O11 — CID 11828072
bis(2,2-dimethylpropanoyloxymethyl) 1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 11828072) has the molecular formula C29H38N2O11 and a molecular weight of 590.63 g/mol. Its IUPAC name is bis(2,2-dimethylpropanoyloxymethyl) 1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | bis(2,2-dimethylpropanoyloxymethyl) 1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11828072 |
| Molecular Formula | C29H38N2O11 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | bis(2,2-dimethylpropanoyloxymethyl) 1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COCN1C(C)=C(C(=O)OCOC(=O)C(C)(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCOC(=O)C(C)(C)C)=C1C |
| InChI | InChI=1S/C29H38N2O11/c1-17-21(24(32)39-15-41-26(34)28(3,4)5)23(19-11-10-12-20(13-19)31(36)37)22(18(2)30(17)14-38-9)25(33)40-16-42-27(35)29(6,7)8/h10-13,23H,14-16H2,1-9H3 |
| InChIKey | KBFZSQLMMDKBSH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 160.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|