C21H24N2O9 — CID 15004130
(4S)-1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-(propanoyloxymethoxycarbonyl)-4H-pyridine-3-carboxylic acid (PubChem CID 15004130) has the molecular formula C21H24N2O9 and a molecular weight of 448.43 g/mol. Its IUPAC name is (4S)-1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-(propanoyloxymethoxycarbonyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | (4S)-1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-(propanoyloxymethoxycarbonyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 15004130 |
| Molecular Formula | C21H24N2O9 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (4S)-1-(methoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-5-(propanoyloxymethoxycarbonyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCC(=O)OCOC(=O)C1=C(C)N(COC)C(C)=C(C(=O)O)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N2O9/c1-5-16(24)31-11-32-21(27)18-13(3)22(10-30-4)12(2)17(20(25)26)19(18)14-7-6-8-15(9-14)23(28)29/h6-9,19H,5,10-11H2,1-4H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | OLZPWLSSGHWDBP-IBGZPJMESA-N |
| XLogP | 2.68 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|