C25H22N2O7 — CID 67944176
1-[3-(4-hydroxyphenyl)prop-2-ynyl]-5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 67944176) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 1-[3-(4-hydroxyphenyl)prop-2-ynyl]-5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 1-[3-(4-hydroxyphenyl)prop-2-ynyl]-5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67944176 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[3-(4-hydroxyphenyl)prop-2-ynyl]-5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | COC(=O)C1=C(C)N(CC#Cc2ccc(O)cc2)C(C)=C(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N2O7/c1-15-21(24(29)30)23(18-7-4-8-19(14-18)27(32)33)22(25(31)34-3)16(2)26(15)13-5-6-17-9-11-20(28)12-10-17/h4,7-12,14,23,28H,13H2,1-3H3,(H,29,30) |
| InChIKey | WPVIXBOKDVEYBP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|