C16H13F3N2O6 — CID 70054780
5-methoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70054780) has the molecular formula C16H13F3N2O6 and a molecular weight of 386.28 g/mol. Its IUPAC name is 5-methoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-methoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70054780 |
| Molecular Formula | C16H13F3N2O6 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 5-methoxycarbonyl-2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13F3N2O6/c1-7-10(14(22)23)11(8-4-3-5-9(6-8)21(25)26)12(15(24)27-2)13(20-7)16(17,18)19/h3-6,11,20H,1-2H3,(H,22,23) |
| InChIKey | NGVPOXSKHYFYJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|