C19H20N2O8 — CID 33030919
(4S)-3-methoxycarbonyl-6-methyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-2-carboxylic acid (PubChem CID 33030919) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is (4S)-3-methoxycarbonyl-6-methyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-2-carboxylic acid.
| Compound Name | (4S)-3-methoxycarbonyl-6-methyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 33030919 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (4S)-3-methoxycarbonyl-6-methyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyl-1,4-dihydropyridine-2-carboxylic acid |
| SMILES | COC(=O)C1=C(C(=O)O)NC(C)=C(C(=O)OC(C)C)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N2O8/c1-9(2)29-19(25)13-10(3)20-16(17(22)23)15(18(24)28-4)14(13)11-6-5-7-12(8-11)21(26)27/h5-9,14,20H,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | GETMHKKRBXPTJZ-AWEZNQCLSA-N |
| XLogP | 2.02 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|