C28H30N2O6 — CID 67937742
3-O-methyl 5-O-(4-methyl-1-phenylpent-1-en-3-yl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67937742) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-O-methyl 5-O-(4-methyl-1-phenylpent-1-en-3-yl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(4-methyl-1-phenylpent-1-en-3-yl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67937742 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-O-methyl 5-O-(4-methyl-1-phenylpent-1-en-3-yl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C=Cc2ccccc2)C(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H30N2O6/c1-17(2)23(15-14-20-10-7-6-8-11-20)36-28(32)25-19(4)29-18(3)24(27(31)35-5)26(25)21-12-9-13-22(16-21)30(33)34/h6-17,23,26,29H,1-5H3 |
| InChIKey | JAKXGEPKVUIGER-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|