C33H30N2O6 — CID 70431999
bis[(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70431999) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is bis[(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70431999 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | bis[(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC/C=C\c2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC/C=C\c2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C33H30N2O6/c1-23-29(32(36)40-20-10-16-25-12-5-3-6-13-25)31(27-18-9-19-28(22-27)35(38)39)30(24(2)34-23)33(37)41-21-11-17-26-14-7-4-8-15-26/h3-19,22,31,34H,20-21H2,1-2H3/b16-10-,17-11- |
| InChIKey | UXABONBQLAQFKO-APGQMXJTSA-N |
| XLogP | 6.34 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|