C28H25N3O4 — CID 14998939
[(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate (PubChem CID 14998939) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is [(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | [(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 14998939 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | [(Z)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-5-pyridin-3-yl-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC/C=C\c2ccccc2)C(c2cccc([N+](=O)[O-])c2)C(c2cccnc2)=C(C)N1 |
| InChI | InChI=1S/C28H25N3O4/c1-19-25(23-13-7-15-29-18-23)27(22-12-6-14-24(17-22)31(33)34)26(20(2)30-19)28(32)35-16-8-11-21-9-4-3-5-10-21/h3-15,17-18,27,30H,16H2,1-2H3/b11-8- |
| InChIKey | BZFKGLQBDLTRHR-FLIBITNWSA-N |
| XLogP | 5.64 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|