C25H29N3O7W — CID 163290661
2-methoxyethanol;[(E)-3-pyridin-4-ylprop-2-enyl] 5-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;tungsten (PubChem CID 163290661) has the molecular formula C25H29N3O7W and a molecular weight of 667.36 g/mol. Its IUPAC name is 2-methoxyethanol;[(E)-3-pyridin-4-ylprop-2-enyl] 5-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;tungsten.
| Compound Name | 2-methoxyethanol;[(E)-3-pyridin-4-ylprop-2-enyl] 5-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;tungsten |
|---|---|
| PubChem CID | 163290661 |
| Molecular Formula | C25H29N3O7W |
| Molecular Weight | 667.36 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | 2-methoxyethanol;[(E)-3-pyridin-4-ylprop-2-enyl] 5-hydroxy-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate;tungsten |
| SMILES | CC1=C(O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC/C=C/c2ccncc2)=C(C)N1.COCCO.[W] |
| InChI | InChI=1S/C22H21N3O5.C3H8O2.W/c1-14-19(22(27)30-12-4-5-16-8-10-23-11-9-16)20(21(26)15(2)24-14)17-6-3-7-18(13-17)25(28)29;1-5-3-2-4;/h3-11,13,20,24,26H,12H2,1-2H3;4H,2-3H2,1H3;/b5-4+;; |
| InChIKey | LWHBEIQRGROSAN-SFKRKKMESA-N |
| XLogP | 3.62 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|