C23H22N2O7 — CID 3064391
5-O-[3-(furan-2-yl)prop-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 3064391) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is 5-O-[3-(furan-2-yl)prop-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-(furan-2-yl)prop-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 3064391 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 5-O-[3-(furan-2-yl)prop-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=Cc2ccco2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N2O7/c1-14-19(22(26)30-3)21(16-7-4-8-17(13-16)25(28)29)20(15(2)24-14)23(27)32-12-6-10-18-9-5-11-31-18/h4-11,13,21,24H,12H2,1-3H3 |
| InChIKey | HDOAVYJMUWBPSW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|