C27H30N2O6 — CID 86741578
bis(hexa-2,4-dienyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 86741578) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is bis(hexa-2,4-dienyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(hexa-2,4-dienyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 86741578 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | bis(hexa-2,4-dienyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC=CC=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=CC=CC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N2O6/c1-5-7-9-11-16-34-26(30)23-19(3)28-20(4)24(27(31)35-17-12-10-8-6-2)25(23)21-14-13-15-22(18-21)29(32)33/h5-15,18,25,28H,16-17H2,1-4H3 |
| InChIKey | UGFPCGKOSJAHRY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|