C19H26Cl2N4O6 — CID 70103681
bis(2-aminoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride (PubChem CID 70103681) has the molecular formula C19H26Cl2N4O6 and a molecular weight of 477.35 g/mol. Its IUPAC name is bis(2-aminoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride.
| Compound Name | bis(2-aminoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 70103681 |
| Molecular Formula | C19H26Cl2N4O6 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | bis(2-aminoethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;dihydrochloride |
| SMILES | CC1=C(C(=O)OCCN)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCN)=C(C)N1.Cl.Cl |
| InChI | InChI=1S/C19H24N4O6.2ClH/c1-11-15(18(24)28-8-6-20)17(13-4-3-5-14(10-13)23(26)27)16(12(2)22-11)19(25)29-9-7-21;;/h3-5,10,17,22H,6-9,20-21H2,1-2H3;2*1H |
| InChIKey | SYMJSLQDMNSPGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 159.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|